(S)-3-(1-Amino-2,2-dimethylpropyl)-4-fluorobenzoic acid hydrochloride
Modify Date: 2025-09-02 11:40:35
(S)-3-(1-Amino-2,2-dimethylpropyl)-4-fluorobenzoic acid hydrochloride structure
|
Common Name | (S)-3-(1-Amino-2,2-dimethylpropyl)-4-fluorobenzoic acid hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2708341-58-4 | Molecular Weight | 261.72 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17ClFNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (S)-3-(1-Amino-2,2-dimethylpropyl)-4-fluorobenzoic acid hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H17ClFNO2 |
|---|---|
| Molecular Weight | 261.72 |
| InChIKey | IVRCQYSYEBQHMO-HNCPQSOCSA-N |
| SMILES | CC(C)(C)C(N)c1cc(C(=O)O)ccc1F.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (S)-3-(1-Amino-2,2-dimethylpropyl)-4-fluorobenzoic acid hydrochloride? |
| A: Molecular weight of (S)-3-(1-Amino-2,2-dimethylpropyl)-4-fluorobenzoic acid hydrochloride is 261.72. |
| Q: What is the InChIKey of (S)-3-(1-Amino-2,2-dimethylpropyl)-4-fluorobenzoic acid hydrochloride? |
| A: InChIKey of (S)-3-(1-Amino-2,2-dimethylpropyl)-4-fluorobenzoic acid hydrochloride is IVRCQYSYEBQHMO-HNCPQSOCSA-N. |
| Q: What is the CAS number of (S)-3-(1-Amino-2,2-dimethylpropyl)-4-fluorobenzoic acid hydrochloride? |
| A: CAS number of (S)-3-(1-Amino-2,2-dimethylpropyl)-4-fluorobenzoic acid hydrochloride is 2708341-58-4. |
| Q: What is the Chinese name of 2708341-58-4? |
| A: Chinese name of 2708341-58-4 is 2708341-58-4. |
| Q: What is the SMILES notation of (S)-3-(1-Amino-2,2-dimethylpropyl)-4-fluorobenzoic acid hydrochloride? |
| A: SMILES notation of (S)-3-(1-Amino-2,2-dimethylpropyl)-4-fluorobenzoic acid hydrochloride is CC(C)(C)C(N)c1cc(C(=O)O)ccc1F.Cl. |
| Q: What is the English name of (S)-3-(1-Amino-2,2-dimethylpropyl)-4-fluorobenzoic acid hydrochloride? |
| A: The English name of (S)-3-(1-Amino-2,2-dimethylpropyl)-4-fluorobenzoic acid hydrochloride is (S)-3-(1-Amino-2,2-dimethylpropyl)-4-fluorobenzoic acid hydrochloride. |
| Q: What is the molecular formula of (S)-3-(1-Amino-2,2-dimethylpropyl)-4-fluorobenzoic acid hydrochloride? |
| A: Molecular formula of (S)-3-(1-Amino-2,2-dimethylpropyl)-4-fluorobenzoic acid hydrochloride is C12H17ClFNO2. |