(S)-4-(1-Aminobut-3-EN-1-YL)-N,N-dimethylaniline dihydrochloride
Modify Date: 2026-08-19 15:58:14
(S)-4-(1-Aminobut-3-EN-1-YL)-N,N-dimethylaniline dihydrochloride structure
|
Common Name | (S)-4-(1-Aminobut-3-EN-1-YL)-N,N-dimethylaniline dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2708343-29-5 | Molecular Weight | 263.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H20Cl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (S)-4-(1-Aminobut-3-EN-1-YL)-N,N-dimethylaniline dihydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H20Cl2N2 |
|---|---|
| Molecular Weight | 263.20 |
| InChIKey | RBWCQWXFYQOHDK-LTCKWSDVSA-N |
| SMILES | C=CCC(N)c1ccc(N(C)C)cc1.Cl.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (S)-4-(1-Aminobut-3-EN-1-YL)-N,N-dimethylaniline dihydrochloride? |
| A: Molecular weight of (S)-4-(1-Aminobut-3-EN-1-YL)-N,N-dimethylaniline dihydrochloride is 263.20. |
| Q: What is the CAS number of (S)-4-(1-Aminobut-3-EN-1-YL)-N,N-dimethylaniline dihydrochloride? |
| A: CAS number of (S)-4-(1-Aminobut-3-EN-1-YL)-N,N-dimethylaniline dihydrochloride is 2708343-29-5. |
| Q: What is the SMILES notation of (S)-4-(1-Aminobut-3-EN-1-YL)-N,N-dimethylaniline dihydrochloride? |
| A: SMILES notation of (S)-4-(1-Aminobut-3-EN-1-YL)-N,N-dimethylaniline dihydrochloride is C=CCC(N)c1ccc(N(C)C)cc1.Cl.Cl. |
| Q: What is the English name of (S)-4-(1-Aminobut-3-EN-1-YL)-N,N-dimethylaniline dihydrochloride? |
| A: The English name of (S)-4-(1-Aminobut-3-EN-1-YL)-N,N-dimethylaniline dihydrochloride is (S)-4-(1-Aminobut-3-EN-1-YL)-N,N-dimethylaniline dihydrochloride. |
| Q: What is the InChIKey of (S)-4-(1-Aminobut-3-EN-1-YL)-N,N-dimethylaniline dihydrochloride? |
| A: InChIKey of (S)-4-(1-Aminobut-3-EN-1-YL)-N,N-dimethylaniline dihydrochloride is RBWCQWXFYQOHDK-LTCKWSDVSA-N. |
| Q: What is the Chinese name of 2708343-29-5? |
| A: Chinese name of 2708343-29-5 is 2708343-29-5. |
| Q: What is the molecular formula of (S)-4-(1-Aminobut-3-EN-1-YL)-N,N-dimethylaniline dihydrochloride? |
| A: Molecular formula of (S)-4-(1-Aminobut-3-EN-1-YL)-N,N-dimethylaniline dihydrochloride is C12H20Cl2N2. |