Methyl (S)-2-amino-2-(2,3,6-trifluorophenyl)acetate hydrochloride
Modify Date: 2025-09-17 13:08:18
Methyl (S)-2-amino-2-(2,3,6-trifluorophenyl)acetate hydrochloride structure
|
Common Name | Methyl (S)-2-amino-2-(2,3,6-trifluorophenyl)acetate hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2708343-50-2 | Molecular Weight | 255.62 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9ClF3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl (S)-2-amino-2-(2,3,6-trifluorophenyl)acetate hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H9ClF3NO2 |
|---|---|
| Molecular Weight | 255.62 |
| InChIKey | MRLBFSMRRPZVFZ-QRPNPIFTSA-N |
| SMILES | COC(=O)C(N)c1c(F)ccc(F)c1F.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Methyl (S)-2-amino-2-(2,3,6-trifluorophenyl)acetate hydrochloride? |
| A: The English name of Methyl (S)-2-amino-2-(2,3,6-trifluorophenyl)acetate hydrochloride is Methyl (S)-2-amino-2-(2,3,6-trifluorophenyl)acetate hydrochloride. |
| Q: What is the Chinese name of 2708343-50-2? |
| A: Chinese name of 2708343-50-2 is 2708343-50-2. |
| Q: What is the SMILES notation of Methyl (S)-2-amino-2-(2,3,6-trifluorophenyl)acetate hydrochloride? |
| A: SMILES notation of Methyl (S)-2-amino-2-(2,3,6-trifluorophenyl)acetate hydrochloride is COC(=O)C(N)c1c(F)ccc(F)c1F.Cl. |
| Q: What is the molecular weight of Methyl (S)-2-amino-2-(2,3,6-trifluorophenyl)acetate hydrochloride? |
| A: Molecular weight of Methyl (S)-2-amino-2-(2,3,6-trifluorophenyl)acetate hydrochloride is 255.62. |
| Q: What is the CAS number of Methyl (S)-2-amino-2-(2,3,6-trifluorophenyl)acetate hydrochloride? |
| A: CAS number of Methyl (S)-2-amino-2-(2,3,6-trifluorophenyl)acetate hydrochloride is 2708343-50-2. |
| Q: What is the molecular formula of Methyl (S)-2-amino-2-(2,3,6-trifluorophenyl)acetate hydrochloride? |
| A: Molecular formula of Methyl (S)-2-amino-2-(2,3,6-trifluorophenyl)acetate hydrochloride is C9H9ClF3NO2. |
| Q: What is the InChIKey of Methyl (S)-2-amino-2-(2,3,6-trifluorophenyl)acetate hydrochloride? |
| A: InChIKey of Methyl (S)-2-amino-2-(2,3,6-trifluorophenyl)acetate hydrochloride is MRLBFSMRRPZVFZ-QRPNPIFTSA-N. |