ethyl [3-(10,11-dihydro-5H-dibenz[b,f]azepin-5-yl)propyl]methylcarbamate structure
|
Common Name | ethyl [3-(10,11-dihydro-5H-dibenz[b,f]azepin-5-yl)propyl]methylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 27097-69-4 | Molecular Weight | 338.44300 | |
| Density | 1.107g/cm3 | Boiling Point | 473.4ºC at 760mmHg | |
| Molecular Formula | C21H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.1ºC | |
| Name | ethyl N-[3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)propyl]-N-methylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.107g/cm3 |
|---|---|
| Boiling Point | 473.4ºC at 760mmHg |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.44300 |
| Flash Point | 240.1ºC |
| Exact Mass | 338.19900 |
| PSA | 32.78000 |
| LogP | 4.46670 |
| Vapour Pressure | 3.93E-09mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | LHIUCHNQBHLYMH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N(C)CCCN1c2ccccc2CCc2ccccc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Carbamic acid,[3-(10,11-dihydro-5H-dibenz[b,f]azepin-5-yl)propyl]methyl-,ethyl ester(7CI,8CI,9CI) |
| 5(3-<N-(Carboxy)-methylamino>propyl)iminodibenzyl |
| ethyl [3-(10,11-dihydro-5H-dibenz[b,f]azepin-5-yl)propyl]methylcarbamate |
| 5H-Dibenz[b,f]azepine,carbamic acid deriv. |
| EINECS 248-225-5 |