BC3Nar7TV9
Modify Date: 2025-09-01 17:46:49
BC3Nar7TV9 structure
|
Common Name | BC3Nar7TV9 | ||
|---|---|---|---|---|
| CAS Number | 2710292-19-4 | Molecular Weight | 804.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C41H40N8O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | BC3Nar7TV9 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C41H40N8O8S |
|---|---|
| Molecular Weight | 804.9 |
| InChIKey | HRTDXYPAIIXIKY-GVGVJZOBSA-N |
| SMILES | CS(=O)(=O)O.O=C1C(Cc2ccc(O)cc2)N2C(=O)CN(Cc3cc(-c4ccccn4)no3)N(C(=O)NCc3ccccc3)C2CN1Cc1cccc2ncccc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of BC3Nar7TV9? |
| A: SMILES notation of BC3Nar7TV9 is CS(=O)(=O)O.O=C1C(Cc2ccc(O)cc2)N2C(=O)CN(Cc3cc(-c4ccccn4)no3)N(C(=O)NCc3ccccc3)C2CN1Cc1cccc2ncccc12. |
| Q: What is the InChIKey of BC3Nar7TV9? |
| A: InChIKey of BC3Nar7TV9 is HRTDXYPAIIXIKY-GVGVJZOBSA-N. |
| Q: What is the English name of BC3Nar7TV9? |
| A: The English name of BC3Nar7TV9 is BC3Nar7TV9. |
| Q: What is the Chinese name of 2710292-19-4? |
| A: Chinese name of 2710292-19-4 is 2710292-19-4. |
| Q: What is the CAS number of BC3Nar7TV9? |
| A: CAS number of BC3Nar7TV9 is 2710292-19-4. |
| Q: What is the molecular formula of BC3Nar7TV9? |
| A: Molecular formula of BC3Nar7TV9 is C41H40N8O8S. |
| Q: What is the molecular weight of BC3Nar7TV9? |
| A: Molecular weight of BC3Nar7TV9 is 804.9. |