3-[2-chloro-5-(trifluoromethyl)phenyl]-1,1-dimethylurea structure
|
Common Name | 3-[2-chloro-5-(trifluoromethyl)phenyl]-1,1-dimethylurea | ||
|---|---|---|---|---|
| CAS Number | 2711-20-8 | Molecular Weight | 266.64700 | |
| Density | 1.39g/cm3 | Boiling Point | 344.8ºC at 760mmHg | |
| Molecular Formula | C10H10ClF3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.3ºC | |
| Name | 3-[2-chloro-5-(trifluoromethyl)phenyl]-1,1-dimethylurea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 344.8ºC at 760mmHg |
| Molecular Formula | C10H10ClF3N2O |
| Molecular Weight | 266.64700 |
| Flash Point | 162.3ºC |
| Exact Mass | 266.04300 |
| PSA | 35.83000 |
| LogP | 3.46590 |
| Vapour Pressure | 6.44E-05mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | WPKYGXCUDANURX-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| einecs 220-305-4 |