Benzoyl chloride,4-[2-[4-(dimethylamino)phenyl]diazenyl]- structure
|
Common Name | Benzoyl chloride,4-[2-[4-(dimethylamino)phenyl]diazenyl]- | ||
|---|---|---|---|---|
| CAS Number | 27128-58-1 | Molecular Weight | 287.74400 | |
| Density | 1.18g/cm3 | Boiling Point | 441.1ºC at 760mmHg | |
| Molecular Formula | C15H14ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.6ºC | |
| Name | 4-[[4-(dimethylamino)phenyl]diazenyl]benzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 441.1ºC at 760mmHg |
| Molecular Formula | C15H14ClN3O |
| Molecular Weight | 287.74400 |
| Flash Point | 220.6ºC |
| Exact Mass | 287.08300 |
| PSA | 45.03000 |
| LogP | 4.54700 |
| Vapour Pressure | 5.59E-08mmHg at 25°C |
| Index of Refraction | 1.59 |
| InChIKey | WXFLCZCPUXDOOT-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(N=Nc2ccc(C(=O)Cl)cc2)cc1 |
|
~%
Benzoyl chlorid... CAS#:27128-58-1 |
| Literature: Bergbreiter, David E.; Sung, Shayna D.; Li, Jun; Ortiz, Denisse; Hamilton, Patrick N. Organic Process Research and Development, 2004 , vol. 8, # 3 p. 461 - 468 |
| N,N-dimethyl-p-aminophenylazobenzoyl chloride |
| p-(N,N-Dimethylamino)benzol-p'-azo-benzoylchlorid |
| 4-[(4-dimethylaminophenyl)diazenyl]benzoyl chloride |