Phenol, 3-fluoro-,1-benzoate structure
|
Common Name | Phenol, 3-fluoro-,1-benzoate | ||
|---|---|---|---|---|
| CAS Number | 2714-92-3 | Molecular Weight | 216.20800 | |
| Density | 1.221g/cm3 | Boiling Point | 313.2ºC at 760 mmHg | |
| Molecular Formula | C13H9FO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.6ºC | |
| Name | (3-fluorophenyl) benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.221g/cm3 |
|---|---|
| Boiling Point | 313.2ºC at 760 mmHg |
| Molecular Formula | C13H9FO2 |
| Molecular Weight | 216.20800 |
| Flash Point | 138.6ºC |
| Exact Mass | 216.05900 |
| PSA | 26.30000 |
| LogP | 3.04490 |
| Vapour Pressure | 0.000505mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | PAUOKIZUAVMFGH-UHFFFAOYSA-N |
| SMILES | O=C(Oc1cccc(F)c1)c1ccccc1 |
|
~%
Phenol, 3-fluor... CAS#:2714-92-3 |
| Literature: Nummert, Vilve; Travnikova, Oksana; Vahur, Signe; Leito, Ivo; Piirsalu, Mare; Maeemets, Vahur; Koppel, Ivar; Koppel, Ilmar A. Journal of Physical Organic Chemistry, 2006 , vol. 19, # 10 p. 654 - 663 |
|
~4%
Detail
|
| Literature: Allen, Kim J.; Bolton, Roger; Williams, Gareth H. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1983 , p. 691 - 696 |
| m-fluorophenyl benzoate |
| 3-Fluorphenyl-benzoat |
| Benzoesaeure-<3-fluor-phenylester> |
| Phenol,3-fluoro-,1-benzoate |
| 3-fluorophenyl benzoate |
| (m-Fluorphenyl)-benzoat |