6-(2-AMINO-PHENYL)-3-THIOXO-3,4-DIHYDRO-2H-[1,2,4]TRIAZIN-5-ONE structure
|
Common Name | 6-(2-AMINO-PHENYL)-3-THIOXO-3,4-DIHYDRO-2H-[1,2,4]TRIAZIN-5-ONE | ||
|---|---|---|---|---|
| CAS Number | 27161-64-4 | Molecular Weight | 220.25100 | |
| Density | 1.6g/cm3 | Boiling Point | 481.6ºC at 760mmHg | |
| Molecular Formula | C9H8N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.1ºC | |
| Name | 6-(2-aminophenyl)-3-sulfanylidene-2H-1,2,4-triazin-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6g/cm3 |
|---|---|
| Boiling Point | 481.6ºC at 760mmHg |
| Molecular Formula | C9H8N4OS |
| Molecular Weight | 220.25100 |
| Flash Point | 245.1ºC |
| Exact Mass | 220.04200 |
| PSA | 119.65000 |
| LogP | 1.65790 |
| Vapour Pressure | 6.69E-10mmHg at 25°C |
| Index of Refraction | 1.79 |
| InChIKey | TZQIBJNEKJDVAM-UHFFFAOYSA-N |
| SMILES | Nc1ccccc1-c1n[nH]c(=S)[nH]c1=O |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 6-o-Aminophenyl-3-thio-as-triazin-3,5-<2H |
| 6-(2-aminophenyl)-3-sulfanyl-1,2,4-triazin-5(4H)-one |
| 3-Mercapto-5-hydroxy-6-(2-aminophenyl)-1,2,4-triazin |
| 6-(2-Amino-phenyl)-3-thioxo-3,4-dihydro-2H-[1,2,4]triazin-5-one |
| 3-thioxo-6-(2-aminophenyl)-1,2,4-triazin-5(2H,4H)-one |
| 6-(2-aminophenyl)-3-thio-1,2,4-triazine-3,5-(2H,4H)-dione |
| 6-(2-aminophenyl)-3-thioxo-3,4-dihydro-1,2,4-triazin-5(2H)-one |