2,6-dimethyl-3-(2-methylphenyl)pyrimidin-4-one structure
|
Common Name | 2,6-dimethyl-3-(2-methylphenyl)pyrimidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 2722-66-9 | Molecular Weight | 214.26300 | |
| Density | 1.09g/cm3 | Boiling Point | 328.5ºC at 760 mmHg | |
| Molecular Formula | C13H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.5ºC | |
| Name | 2,6-dimethyl-3-(2-methylphenyl)pyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 328.5ºC at 760 mmHg |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.26300 |
| Flash Point | 152.5ºC |
| Exact Mass | 214.11100 |
| PSA | 34.89000 |
| LogP | 2.15770 |
| Vapour Pressure | 0.000188mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | QTIABAXHYMHAGN-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)n(-c2ccccc2C)c(C)n1 |
|
~52%
2,6-dimethyl-3-... CAS#:2722-66-9 |
| Literature: Gupta, K. A.; Saxena, Anil K.; Jain, Padam C.; Srimal, R. C.; Kar, K.; Anand, Nitya Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1983 , vol. 22, # 4 p. 384 - 387 |
|
~%
2,6-dimethyl-3-... CAS#:2722-66-9 |
| Literature: Gupta, K. A.; Saxena, Anil K.; Jain, Padam C.; Srimal, R. C.; Kar, K.; Anand, Nitya Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1983 , vol. 22, # 4 p. 384 - 387 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,6-dimethyl-3-o-tolyl-3H-pyrimidin-4-one |
| 2,6-Dimethyl-3-(2-methylphenyl)-4(3H)-pyrimidinone |
| 4(3H)-Pyrimidinone,2,6-dimethyl-3-(2-methylphenyl) |