butyl prop-2-enoate,N-(hydroxymethyl)prop-2-enamide,methyl 2-methylprop-2-enoate structure
|
Common Name | butyl prop-2-enoate,N-(hydroxymethyl)prop-2-enamide,methyl 2-methylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 27235-04-7 | Molecular Weight | 329.38900 | |
| Density | N/A | Boiling Point | 145.9ºC at 760mmHg | |
| Molecular Formula | C16H27NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 39.4ºC | |
| Name | butyl prop-2-enoate,N-(hydroxymethyl)prop-2-enamide,methyl 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 145.9ºC at 760mmHg |
|---|---|
| Molecular Formula | C16H27NO6 |
| Molecular Weight | 329.38900 |
| Flash Point | 39.4ºC |
| Exact Mass | 329.18400 |
| PSA | 105.42000 |
| LogP | 2.32990 |
| InChIKey | FTSSEORPRUYSEZ-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OC.C=CC(=O)NCO.C=CC(=O)OCCCC |
| Methyl methacrylate,butyl acrylate,N-methylolacrylamide polymer |
| 2-Propenoic acid,2-methyl-,methyl ester,polymer with butyl 2-propenoate and N-(hydroxymethyl)-2-propenamide |
| Methyl methacrylate,N-methylolacrylamide,butyl acrylate polymer |