ethyl (Z)-3-diethoxyphosphoryloxy-3-phenyl-prop-2-enoate structure
|
Common Name | ethyl (Z)-3-diethoxyphosphoryloxy-3-phenyl-prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 27238-13-7 | Molecular Weight | 328.29700 | |
| Density | 1.174g/cm3 | Boiling Point | 400.8ºC at 760mmHg | |
| Molecular Formula | C15H21O6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.7ºC | |
| Name | ethyl 3-diethoxyphosphoryloxy-3-phenylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.174g/cm3 |
|---|---|
| Boiling Point | 400.8ºC at 760mmHg |
| Molecular Formula | C15H21O6P |
| Molecular Weight | 328.29700 |
| Flash Point | 209.7ºC |
| Exact Mass | 328.10800 |
| PSA | 80.87000 |
| LogP | 3.78830 |
| Vapour Pressure | 1.24E-06mmHg at 25°C |
| Index of Refraction | 1.501 |
| InChIKey | ZSQCNQOWYXWZNY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C=C(OP(=O)(OCC)OCC)c1ccccc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| O,O-Diaethyl-O-(1-phenyl-2-aethoxycarbonyl-vinyl)-phosphat |
| (1-Phenyl-2-aethoxycarbonyl-vinyl)-diaethylphosphat |
| ETHYL (Z)-3-DIETHOXYPHOSPHORYLOXY-3-PHENYL-PROP-2-ENOATE |
| ethyl 3-[(diethoxyphosphoryl)oxy]-3-phenylprop-2-enoate |