2,5-Cyclohexadiene-1,4-dione,2,5-bis(4-butylphenyl)-3,6-dihydroxy- structure
|
Common Name | 2,5-Cyclohexadiene-1,4-dione,2,5-bis(4-butylphenyl)-3,6-dihydroxy- | ||
|---|---|---|---|---|
| CAS Number | 27246-39-5 | Molecular Weight | 404.49800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H28O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,5-bis(4-butylphenyl)-3,6-dihydroxycyclohexa-2,5-diene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H28O4 |
|---|---|
| Molecular Weight | 404.49800 |
| Exact Mass | 404.19900 |
| PSA | 74.60000 |
| LogP | 5.76200 |
| InChIKey | CMAPBQSQMJIHSS-UHFFFAOYSA-N |
| SMILES | CCCCc1ccc(C2=C(O)C(=O)C(c3ccc(CCCC)cc3)=C(O)C2=O)cc1 |
|
~%
2,5-Cyclohexadi... CAS#:27246-39-5 |
| Literature: Zee-Cheng,K.-Y.; Cheng,C.C. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 264 - 268 |
|
~%
2,5-Cyclohexadi... CAS#:27246-39-5 |
| Literature: Zee-Cheng,K.-Y.; Cheng,C.C. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 264 - 268 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,5-Bis(4-butylphenyl)-3,6-dihydroxybenzo-1,4-quinone |