1-Piperazineethanol,4-(4-methylphenyl)-a-(phenoxymethyl)- structure
|
Common Name | 1-Piperazineethanol,4-(4-methylphenyl)-a-(phenoxymethyl)- | ||
|---|---|---|---|---|
| CAS Number | 2725-12-4 | Molecular Weight | 326.43300 | |
| Density | 1.127g/cm3 | Boiling Point | 511.1ºC at 760 mmHg | |
| Molecular Formula | C20H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.9ºC | |
| Name | 1-[4-(4-methylphenyl)piperazin-1-yl]-3-phenoxypropan-2-ol |
|---|
| Density | 1.127g/cm3 |
|---|---|
| Boiling Point | 511.1ºC at 760 mmHg |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.43300 |
| Flash Point | 262.9ºC |
| Exact Mass | 326.19900 |
| PSA | 35.94000 |
| LogP | 2.55980 |
| Vapour Pressure | 2.87E-11mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | BUELKERURUOIFV-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N2CCN(CC(O)COc3ccccc3)CC2)cc1 |
|
~%
1-Piperazineeth... CAS#:2725-12-4 |
| Literature: Pollard; Fernandez Journal of Organic Chemistry, 1958 , vol. 23, p. 1935 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |