4,4'-(2,5-Dioxopiperazine-1,4-diyl)dibenzonitrile
Modify Date: 2025-08-28 21:15:05
4,4'-(2,5-Dioxopiperazine-1,4-diyl)dibenzonitrile structure
|
Common Name | 4,4'-(2,5-Dioxopiperazine-1,4-diyl)dibenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 2733025-09-5 | Molecular Weight | 316.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H12N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,4'-(2,5-Dioxopiperazine-1,4-diyl)dibenzonitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H12N4O2 |
|---|---|
| Molecular Weight | 316.3 |
| InChIKey | SRMGTRQYZAYILR-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(N2CC(=O)N(c3ccc(C#N)cc3)CC2=O)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4,4'-(2,5-Dioxopiperazine-1,4-diyl)dibenzonitrile? |
| A: Molecular weight of 4,4'-(2,5-Dioxopiperazine-1,4-diyl)dibenzonitrile is 316.3. |
| Q: What is the CAS number of 4,4'-(2,5-Dioxopiperazine-1,4-diyl)dibenzonitrile? |
| A: CAS number of 4,4'-(2,5-Dioxopiperazine-1,4-diyl)dibenzonitrile is 2733025-09-5. |
| Q: What is the molecular formula of 4,4'-(2,5-Dioxopiperazine-1,4-diyl)dibenzonitrile? |
| A: Molecular formula of 4,4'-(2,5-Dioxopiperazine-1,4-diyl)dibenzonitrile is C18H12N4O2. |
| Q: What is the InChIKey of 4,4'-(2,5-Dioxopiperazine-1,4-diyl)dibenzonitrile? |
| A: InChIKey of 4,4'-(2,5-Dioxopiperazine-1,4-diyl)dibenzonitrile is SRMGTRQYZAYILR-UHFFFAOYSA-N. |
| Q: What is the English name of 4,4'-(2,5-Dioxopiperazine-1,4-diyl)dibenzonitrile? |
| A: The English name of 4,4'-(2,5-Dioxopiperazine-1,4-diyl)dibenzonitrile is 4,4'-(2,5-Dioxopiperazine-1,4-diyl)dibenzonitrile. |
| Q: What is the SMILES notation of 4,4'-(2,5-Dioxopiperazine-1,4-diyl)dibenzonitrile? |
| A: SMILES notation of 4,4'-(2,5-Dioxopiperazine-1,4-diyl)dibenzonitrile is N#Cc1ccc(N2CC(=O)N(c3ccc(C#N)cc3)CC2=O)cc1. |
| Q: What is the Chinese name of 2733025-09-5? |
| A: Chinese name of 2733025-09-5 is 2733025-09-5. |