1,10-Phenanthrolin-4-ol,2,9-dimethyl- structure
|
Common Name | 1,10-Phenanthrolin-4-ol,2,9-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 27337-58-2 | Molecular Weight | 224.25800 | |
| Density | 1.22g/cm3 | Boiling Point | 393ºC at 760mmHg | |
| Molecular Formula | C14H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.5ºC | |
| Name | 2,9-dimethyl-1H-1,10-phenanthrolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 393ºC at 760mmHg |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.25800 |
| Flash Point | 191.5ºC |
| Exact Mass | 224.09500 |
| PSA | 46.01000 |
| LogP | 3.10540 |
| Vapour Pressure | 2.2E-06mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | OVXHELNHLDLYEY-UHFFFAOYSA-N |
| SMILES | Cc1ccc2ccc3c(=O)cc(C)[nH]c3c2n1 |
|
~%
1,10-Phenanthro... CAS#:27337-58-2 |
| Literature: Mullins, Stephen T.; Sammes, Peter G.; West, Richard M.; Yahioglu, Gokhan Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1996 , # 1 p. 75 - 82 |
|
~%
1,10-Phenanthro... CAS#:27337-58-2 |
| Literature: Mullins, Stephen T.; Sammes, Peter G.; West, Richard M.; Yahioglu, Gokhan Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1996 , # 1 p. 75 - 82 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,9-dimethyl-1,10-phenanthrolin-4(1h)-one |
| 2,9-Dimethyl(1,10)phenanthrolin-4-ol |
| 4-hydroxy-2,9-dimethyl-1,10-phenanthrolin |
| 2,9-dimethyl-1H-[1,10]phenanthrolin-4-one |