2-Chloro-4-ethyl-1,1'-biphenyl
Modify Date: 2026-07-28 11:54:10
2-Chloro-4-ethyl-1,1'-biphenyl structure
|
Common Name | 2-Chloro-4-ethyl-1,1'-biphenyl | ||
|---|---|---|---|---|
| CAS Number | 2734775-13-2 | Molecular Weight | 216.70 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13Cl | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Chloro-4-ethyl-1,1'-biphenyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H13Cl |
|---|---|
| Molecular Weight | 216.70 |
| InChIKey | HCXLRQURMLCYFH-UHFFFAOYSA-N |
| SMILES | CCc1ccc(-c2ccccc2)c(Cl)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-Chloro-4-ethyl-1,1'-biphenyl? |
| A: CAS number of 2-Chloro-4-ethyl-1,1'-biphenyl is 2734775-13-2. |
| Q: What is the English name of 2-Chloro-4-ethyl-1,1'-biphenyl? |
| A: The English name of 2-Chloro-4-ethyl-1,1'-biphenyl is 2-Chloro-4-ethyl-1,1'-biphenyl. |
| Q: What is the molecular weight of 2-Chloro-4-ethyl-1,1'-biphenyl? |
| A: Molecular weight of 2-Chloro-4-ethyl-1,1'-biphenyl is 216.70. |
| Q: What is the molecular formula of 2-Chloro-4-ethyl-1,1'-biphenyl? |
| A: Molecular formula of 2-Chloro-4-ethyl-1,1'-biphenyl is C14H13Cl. |
| Q: What is the SMILES notation of 2-Chloro-4-ethyl-1,1'-biphenyl? |
| A: SMILES notation of 2-Chloro-4-ethyl-1,1'-biphenyl is CCc1ccc(-c2ccccc2)c(Cl)c1. |
| Q: What is the InChIKey of 2-Chloro-4-ethyl-1,1'-biphenyl? |
| A: InChIKey of 2-Chloro-4-ethyl-1,1'-biphenyl is HCXLRQURMLCYFH-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2734775-13-2? |
| A: Chinese name of 2734775-13-2 is 2734775-13-2. |