Pyridinium, 2-methyl-1-(phenylmethoxy)-,bromide (1:1) structure
|
Common Name | Pyridinium, 2-methyl-1-(phenylmethoxy)-,bromide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 27371-06-8 | Molecular Weight | 280.16000 | |
| Density | 1.07g/cm3 | Boiling Point | 298.9ºC at 760mmHg | |
| Molecular Formula | C13H14BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 88.1ºC | |
| Name | 2-methyl-1-phenylmethoxypyridin-1-ium,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.07g/cm3 |
|---|---|
| Boiling Point | 298.9ºC at 760mmHg |
| Molecular Formula | C13H14BrNO |
| Molecular Weight | 280.16000 |
| Flash Point | 88.1ºC |
| Exact Mass | 279.02600 |
| PSA | 13.11000 |
| Vapour Pressure | 0.00123mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | AUMPEEHQFDGHPN-UHFFFAOYSA-M |
| SMILES | Cc1cccc[n+]1OCc1ccccc1.[Br-] |
|
~%
Pyridinium, 2-m... CAS#:27371-06-8 |
| Literature: Katritzky, Alan R.; Dega-Szafran, Zofia; Watson, Clifford H.; Eyler, John R. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1990 , # 6 p. 1051 - 1057 |
| Precursor 2 | |
|---|---|
| DownStream 2 | |
| 1-benzyloxy-2-methyl-pyridinium,bromide |
| Pyridinium,2-methyl-1-(phenylmethoxy)-,bromide |