methyl 3-amino-3-(4-nitrophenyl)propanoate structure
|
Common Name | methyl 3-amino-3-(4-nitrophenyl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 273920-24-4 | Molecular Weight | 224.21300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 3-amino-3-(4-nitrophenyl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H12N2O4 |
|---|---|
| Molecular Weight | 224.21300 |
| Exact Mass | 224.08000 |
| PSA | 98.14000 |
| LogP | 2.38120 |
| InChIKey | JGLLZWBBGQKLKV-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(N)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2922499990 |
|---|
|
~97%
methyl 3-amino-... CAS#:273920-24-4 |
| Literature: Celltech RandD Limited Patent: US6953798 B1, 2005 ; Location in patent: Page/Page column 20 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| MFCD18907619 |