Imatinib Acid
Modify Date: 2025-09-26 09:05:06
Imatinib Acid structure
|
Common Name | Imatinib Acid | ||
|---|---|---|---|---|
| CAS Number | 2741007-77-0 | Molecular Weight | 551.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H33N7O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Imatinib Acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C31H33N7O3 |
|---|---|
| Molecular Weight | 551.6 |
| InChIKey | UBEXHJPGGGMXHS-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)c2ccc(CN3CCN(CCC(=O)O)CC3)cc2)cc1Nc1nccc(-c2cccnc2)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Imatinib Acid? |
| A: Molecular formula of Imatinib Acid is C31H33N7O3. |
| Q: What is the Chinese name of 2741007-77-0? |
| A: Chinese name of 2741007-77-0 is 2741007-77-0. |
| Q: What is the CAS number of Imatinib Acid? |
| A: CAS number of Imatinib Acid is 2741007-77-0. |
| Q: What is the SMILES notation of Imatinib Acid? |
| A: SMILES notation of Imatinib Acid is Cc1ccc(NC(=O)c2ccc(CN3CCN(CCC(=O)O)CC3)cc2)cc1Nc1nccc(-c2cccnc2)n1. |
| Q: What is the InChIKey of Imatinib Acid? |
| A: InChIKey of Imatinib Acid is UBEXHJPGGGMXHS-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Imatinib Acid? |
| A: Molecular weight of Imatinib Acid is 551.6. |
| Q: What is the English name of Imatinib Acid? |
| A: The English name of Imatinib Acid is Imatinib Acid. |