3-(1-(2-(3-Methoxyphenyl)acetyl)azetidin-3-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione
Modify Date: 2026-09-21 07:34:42
![3-(1-(2-(3-Methoxyphenyl)acetyl)azetidin-3-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione Structure](https://www.chemsrc.com/extcaspic/089/2741897-00-5.png)
3-(1-(2-(3-Methoxyphenyl)acetyl)azetidin-3-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione structure
|
Common Name | 3-(1-(2-(3-Methoxyphenyl)acetyl)azetidin-3-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 2741897-00-5 | Molecular Weight | 314.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(1-(2-(3-Methoxyphenyl)acetyl)azetidin-3-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H18N2O4 |
|---|---|
| Molecular Weight | 314.34 |
| InChIKey | QLBQOPIDCJVNPN-UHFFFAOYSA-N |
| SMILES | COc1cccc(CC(=O)N2CC(N3C(=O)C4CC4C3=O)C2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-(1-(2-(3-Methoxyphenyl)acetyl)azetidin-3-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione? |
| A: Molecular formula of 3-(1-(2-(3-Methoxyphenyl)acetyl)azetidin-3-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione is C17H18N2O4. |
| Q: What is the molecular weight of 3-(1-(2-(3-Methoxyphenyl)acetyl)azetidin-3-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione? |
| A: Molecular weight of 3-(1-(2-(3-Methoxyphenyl)acetyl)azetidin-3-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione is 314.34. |
| Q: What is the CAS number of 3-(1-(2-(3-Methoxyphenyl)acetyl)azetidin-3-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione? |
| A: CAS number of 3-(1-(2-(3-Methoxyphenyl)acetyl)azetidin-3-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione is 2741897-00-5. |
| Q: What is the Chinese name of 2741897-00-5? |
| A: Chinese name of 2741897-00-5 is 2741897-00-5. |
| Q: What is the SMILES notation of 3-(1-(2-(3-Methoxyphenyl)acetyl)azetidin-3-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione? |
| A: SMILES notation of 3-(1-(2-(3-Methoxyphenyl)acetyl)azetidin-3-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione is COc1cccc(CC(=O)N2CC(N3C(=O)C4CC4C3=O)C2)c1. |
| Q: What is the InChIKey of 3-(1-(2-(3-Methoxyphenyl)acetyl)azetidin-3-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione? |
| A: InChIKey of 3-(1-(2-(3-Methoxyphenyl)acetyl)azetidin-3-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione is QLBQOPIDCJVNPN-UHFFFAOYSA-N. |
| Q: What is the English name of 3-(1-(2-(3-Methoxyphenyl)acetyl)azetidin-3-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione? |
| A: The English name of 3-(1-(2-(3-Methoxyphenyl)acetyl)azetidin-3-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione is 3-(1-(2-(3-Methoxyphenyl)acetyl)azetidin-3-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione. |