N-{4-[(4,6-dimethylpyrimidin-2-yl)oxy]cyclohexyl}-3,5-bis(trifluoromethyl)benzamide structure
|
Common Name | N-{4-[(4,6-dimethylpyrimidin-2-yl)oxy]cyclohexyl}-3,5-bis(trifluoromethyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 2741908-18-7 | Molecular Weight | 461.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H21F6N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-{4-[(4,6-dimethylpyrimidin-2-yl)oxy]cyclohexyl}-3,5-bis(trifluoromethyl)benzamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H21F6N3O2 |
|---|---|
| Molecular Weight | 461.4 |
| InChIKey | GDXPNZGBOZVYOH-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)nc(OC2CCC(NC(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)CC2)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-{4-[(4,6-dimethylpyrimidin-2-yl)oxy]cyclohexyl}-3,5-bis(trifluoromethyl)benzamide? |
| A: CAS number of N-{4-[(4,6-dimethylpyrimidin-2-yl)oxy]cyclohexyl}-3,5-bis(trifluoromethyl)benzamide is 2741908-18-7. |
| Q: What is the molecular formula of N-{4-[(4,6-dimethylpyrimidin-2-yl)oxy]cyclohexyl}-3,5-bis(trifluoromethyl)benzamide? |
| A: Molecular formula of N-{4-[(4,6-dimethylpyrimidin-2-yl)oxy]cyclohexyl}-3,5-bis(trifluoromethyl)benzamide is C21H21F6N3O2. |
| Q: What is the Chinese name of 2741908-18-7? |
| A: Chinese name of 2741908-18-7 is 2741908-18-7. |
| Q: What is the molecular weight of N-{4-[(4,6-dimethylpyrimidin-2-yl)oxy]cyclohexyl}-3,5-bis(trifluoromethyl)benzamide? |
| A: Molecular weight of N-{4-[(4,6-dimethylpyrimidin-2-yl)oxy]cyclohexyl}-3,5-bis(trifluoromethyl)benzamide is 461.4. |
| Q: What is the SMILES notation of N-{4-[(4,6-dimethylpyrimidin-2-yl)oxy]cyclohexyl}-3,5-bis(trifluoromethyl)benzamide? |
| A: SMILES notation of N-{4-[(4,6-dimethylpyrimidin-2-yl)oxy]cyclohexyl}-3,5-bis(trifluoromethyl)benzamide is Cc1cc(C)nc(OC2CCC(NC(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)CC2)n1. |
| Q: What is the English name of N-{4-[(4,6-dimethylpyrimidin-2-yl)oxy]cyclohexyl}-3,5-bis(trifluoromethyl)benzamide? |
| A: The English name of N-{4-[(4,6-dimethylpyrimidin-2-yl)oxy]cyclohexyl}-3,5-bis(trifluoromethyl)benzamide is N-{4-[(4,6-dimethylpyrimidin-2-yl)oxy]cyclohexyl}-3,5-bis(trifluoromethyl)benzamide. |
| Q: What is the InChIKey of N-{4-[(4,6-dimethylpyrimidin-2-yl)oxy]cyclohexyl}-3,5-bis(trifluoromethyl)benzamide? |
| A: InChIKey of N-{4-[(4,6-dimethylpyrimidin-2-yl)oxy]cyclohexyl}-3,5-bis(trifluoromethyl)benzamide is GDXPNZGBOZVYOH-UHFFFAOYSA-N. |