4-({[(2,3-Dihydro-1,4-benzodioxin-6-yl)methyl](methyl)amino}methyl)-3-fluorobenzonitrile
Modify Date: 2026-07-07 11:22:56
amino}methyl)-3-fluorobenzonitrile Structure](https://www.chemsrc.com/extcaspic/368/2741908-63-2.png)
4-({[(2,3-Dihydro-1,4-benzodioxin-6-yl)methyl](methyl)amino}methyl)-3-fluorobenzonitrile structure
|
Common Name | 4-({[(2,3-Dihydro-1,4-benzodioxin-6-yl)methyl](methyl)amino}methyl)-3-fluorobenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 2741908-63-2 | Molecular Weight | 312.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H17FN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-({[(2,3-Dihydro-1,4-benzodioxin-6-yl)methyl](methyl)amino}methyl)-3-fluorobenzonitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H17FN2O2 |
|---|---|
| Molecular Weight | 312.3 |
| InChIKey | IMMJBQFLRJSCEE-UHFFFAOYSA-N |
| SMILES | CN(Cc1ccc2c(c1)OCCO2)Cc1ccc(C#N)cc1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-({[(2,3-Dihydro-1,4-benzodioxin-6-yl)methyl](methyl)amino}methyl)-3-fluorobenzonitrile? |
| A: Molecular formula of 4-({[(2,3-Dihydro-1,4-benzodioxin-6-yl)methyl](methyl)amino}methyl)-3-fluorobenzonitrile is C18H17FN2O2. |
| Q: What is the CAS number of 4-({[(2,3-Dihydro-1,4-benzodioxin-6-yl)methyl](methyl)amino}methyl)-3-fluorobenzonitrile? |
| A: CAS number of 4-({[(2,3-Dihydro-1,4-benzodioxin-6-yl)methyl](methyl)amino}methyl)-3-fluorobenzonitrile is 2741908-63-2. |
| Q: What is the molecular weight of 4-({[(2,3-Dihydro-1,4-benzodioxin-6-yl)methyl](methyl)amino}methyl)-3-fluorobenzonitrile? |
| A: Molecular weight of 4-({[(2,3-Dihydro-1,4-benzodioxin-6-yl)methyl](methyl)amino}methyl)-3-fluorobenzonitrile is 312.3. |
| Q: What is the SMILES notation of 4-({[(2,3-Dihydro-1,4-benzodioxin-6-yl)methyl](methyl)amino}methyl)-3-fluorobenzonitrile? |
| A: SMILES notation of 4-({[(2,3-Dihydro-1,4-benzodioxin-6-yl)methyl](methyl)amino}methyl)-3-fluorobenzonitrile is CN(Cc1ccc2c(c1)OCCO2)Cc1ccc(C#N)cc1F. |
| Q: What is the Chinese name of 2741908-63-2? |
| A: Chinese name of 2741908-63-2 is 2741908-63-2. |
| Q: What is the English name of 4-({[(2,3-Dihydro-1,4-benzodioxin-6-yl)methyl](methyl)amino}methyl)-3-fluorobenzonitrile? |
| A: The English name of 4-({[(2,3-Dihydro-1,4-benzodioxin-6-yl)methyl](methyl)amino}methyl)-3-fluorobenzonitrile is 4-({[(2,3-Dihydro-1,4-benzodioxin-6-yl)methyl](methyl)amino}methyl)-3-fluorobenzonitrile. |
| Q: What is the InChIKey of 4-({[(2,3-Dihydro-1,4-benzodioxin-6-yl)methyl](methyl)amino}methyl)-3-fluorobenzonitrile? |
| A: InChIKey of 4-({[(2,3-Dihydro-1,4-benzodioxin-6-yl)methyl](methyl)amino}methyl)-3-fluorobenzonitrile is IMMJBQFLRJSCEE-UHFFFAOYSA-N. |