3-(2-fluorophenyl)-N-{2-[5-(furan-2-yl)thiophen-2-yl]ethyl}propanamide
Modify Date: 2025-08-20 17:00:08
![3-(2-fluorophenyl)-N-{2-[5-(furan-2-yl)thiophen-2-yl]ethyl}propanamide Structure](https://www.chemsrc.com/extcaspic/047/2741908-76-7.png)
3-(2-fluorophenyl)-N-{2-[5-(furan-2-yl)thiophen-2-yl]ethyl}propanamide structure
|
Common Name | 3-(2-fluorophenyl)-N-{2-[5-(furan-2-yl)thiophen-2-yl]ethyl}propanamide | ||
|---|---|---|---|---|
| CAS Number | 2741908-76-7 | Molecular Weight | 343.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H18FNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2-fluorophenyl)-N-{2-[5-(furan-2-yl)thiophen-2-yl]ethyl}propanamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H18FNO2S |
|---|---|
| Molecular Weight | 343.4 |
| InChIKey | JRBVIFHAARHPEJ-UHFFFAOYSA-N |
| SMILES | O=C(CCc1ccccc1F)NCCc1ccc(-c2ccco2)s1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3-(2-fluorophenyl)-N-{2-[5-(furan-2-yl)thiophen-2-yl]ethyl}propanamide? |
| A: The English name of 3-(2-fluorophenyl)-N-{2-[5-(furan-2-yl)thiophen-2-yl]ethyl}propanamide is 3-(2-fluorophenyl)-N-{2-[5-(furan-2-yl)thiophen-2-yl]ethyl}propanamide. |
| Q: What is the SMILES notation of 3-(2-fluorophenyl)-N-{2-[5-(furan-2-yl)thiophen-2-yl]ethyl}propanamide? |
| A: SMILES notation of 3-(2-fluorophenyl)-N-{2-[5-(furan-2-yl)thiophen-2-yl]ethyl}propanamide is O=C(CCc1ccccc1F)NCCc1ccc(-c2ccco2)s1. |
| Q: What is the CAS number of 3-(2-fluorophenyl)-N-{2-[5-(furan-2-yl)thiophen-2-yl]ethyl}propanamide? |
| A: CAS number of 3-(2-fluorophenyl)-N-{2-[5-(furan-2-yl)thiophen-2-yl]ethyl}propanamide is 2741908-76-7. |
| Q: What is the molecular weight of 3-(2-fluorophenyl)-N-{2-[5-(furan-2-yl)thiophen-2-yl]ethyl}propanamide? |
| A: Molecular weight of 3-(2-fluorophenyl)-N-{2-[5-(furan-2-yl)thiophen-2-yl]ethyl}propanamide is 343.4. |
| Q: What is the InChIKey of 3-(2-fluorophenyl)-N-{2-[5-(furan-2-yl)thiophen-2-yl]ethyl}propanamide? |
| A: InChIKey of 3-(2-fluorophenyl)-N-{2-[5-(furan-2-yl)thiophen-2-yl]ethyl}propanamide is JRBVIFHAARHPEJ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3-(2-fluorophenyl)-N-{2-[5-(furan-2-yl)thiophen-2-yl]ethyl}propanamide? |
| A: Molecular formula of 3-(2-fluorophenyl)-N-{2-[5-(furan-2-yl)thiophen-2-yl]ethyl}propanamide is C19H18FNO2S. |
| Q: What is the Chinese name of 2741908-76-7? |
| A: Chinese name of 2741908-76-7 is 2741908-76-7. |