6-Chloro-2-{1-[(2-methyl-1,3-oxazol-4-yl)methyl]piperidin-4-yl}-1,8-naphthyridine
Modify Date: 2025-09-15 11:51:04
![6-Chloro-2-{1-[(2-methyl-1,3-oxazol-4-yl)methyl]piperidin-4-yl}-1,8-naphthyridine Structure](https://www.chemsrc.com/extcaspic/178/2741948-22-9.png)
6-Chloro-2-{1-[(2-methyl-1,3-oxazol-4-yl)methyl]piperidin-4-yl}-1,8-naphthyridine structure
|
Common Name | 6-Chloro-2-{1-[(2-methyl-1,3-oxazol-4-yl)methyl]piperidin-4-yl}-1,8-naphthyridine | ||
|---|---|---|---|---|
| CAS Number | 2741948-22-9 | Molecular Weight | 342.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H19ClN4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-Chloro-2-{1-[(2-methyl-1,3-oxazol-4-yl)methyl]piperidin-4-yl}-1,8-naphthyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H19ClN4O |
|---|---|
| Molecular Weight | 342.8 |
| InChIKey | QSWQABUVSICOJA-UHFFFAOYSA-N |
| SMILES | Cc1nc(CN2CCC(c3ccc4cc(Cl)cnc4n3)CC2)co1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 6-Chloro-2-{1-[(2-methyl-1,3-oxazol-4-yl)methyl]piperidin-4-yl}-1,8-naphthyridine? |
| A: InChIKey of 6-Chloro-2-{1-[(2-methyl-1,3-oxazol-4-yl)methyl]piperidin-4-yl}-1,8-naphthyridine is QSWQABUVSICOJA-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 6-Chloro-2-{1-[(2-methyl-1,3-oxazol-4-yl)methyl]piperidin-4-yl}-1,8-naphthyridine? |
| A: Molecular weight of 6-Chloro-2-{1-[(2-methyl-1,3-oxazol-4-yl)methyl]piperidin-4-yl}-1,8-naphthyridine is 342.8. |
| Q: What is the CAS number of 6-Chloro-2-{1-[(2-methyl-1,3-oxazol-4-yl)methyl]piperidin-4-yl}-1,8-naphthyridine? |
| A: CAS number of 6-Chloro-2-{1-[(2-methyl-1,3-oxazol-4-yl)methyl]piperidin-4-yl}-1,8-naphthyridine is 2741948-22-9. |
| Q: What is the molecular formula of 6-Chloro-2-{1-[(2-methyl-1,3-oxazol-4-yl)methyl]piperidin-4-yl}-1,8-naphthyridine? |
| A: Molecular formula of 6-Chloro-2-{1-[(2-methyl-1,3-oxazol-4-yl)methyl]piperidin-4-yl}-1,8-naphthyridine is C18H19ClN4O. |
| Q: What is the Chinese name of 2741948-22-9? |
| A: Chinese name of 2741948-22-9 is 2741948-22-9. |
| Q: What is the SMILES notation of 6-Chloro-2-{1-[(2-methyl-1,3-oxazol-4-yl)methyl]piperidin-4-yl}-1,8-naphthyridine? |
| A: SMILES notation of 6-Chloro-2-{1-[(2-methyl-1,3-oxazol-4-yl)methyl]piperidin-4-yl}-1,8-naphthyridine is Cc1nc(CN2CCC(c3ccc4cc(Cl)cnc4n3)CC2)co1. |
| Q: What is the English name of 6-Chloro-2-{1-[(2-methyl-1,3-oxazol-4-yl)methyl]piperidin-4-yl}-1,8-naphthyridine? |
| A: The English name of 6-Chloro-2-{1-[(2-methyl-1,3-oxazol-4-yl)methyl]piperidin-4-yl}-1,8-naphthyridine is 6-Chloro-2-{1-[(2-methyl-1,3-oxazol-4-yl)methyl]piperidin-4-yl}-1,8-naphthyridine. |