1-{[1-(3-bromobenzoyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole
Modify Date: 2026-09-28 11:08:27
![1-{[1-(3-bromobenzoyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole Structure](https://www.chemsrc.com/extcaspic/047/2742005-87-2.png)
1-{[1-(3-bromobenzoyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole structure
|
Common Name | 1-{[1-(3-bromobenzoyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole | ||
|---|---|---|---|---|
| CAS Number | 2742005-87-2 | Molecular Weight | 348.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18BrN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-{[1-(3-bromobenzoyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H18BrN3O |
|---|---|
| Molecular Weight | 348.24 |
| InChIKey | BOJUZPZPZLCJNV-UHFFFAOYSA-N |
| SMILES | CCc1nccn1CC1CN(C(=O)c2cccc(Br)c2)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2742005-87-2? |
| A: Chinese name of 2742005-87-2 is 2742005-87-2. |
| Q: What is the CAS number of 1-{[1-(3-bromobenzoyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole? |
| A: CAS number of 1-{[1-(3-bromobenzoyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole is 2742005-87-2. |
| Q: What is the English name of 1-{[1-(3-bromobenzoyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole? |
| A: The English name of 1-{[1-(3-bromobenzoyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole is 1-{[1-(3-bromobenzoyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole. |
| Q: What is the SMILES notation of 1-{[1-(3-bromobenzoyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole? |
| A: SMILES notation of 1-{[1-(3-bromobenzoyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole is CCc1nccn1CC1CN(C(=O)c2cccc(Br)c2)C1. |
| Q: What is the InChIKey of 1-{[1-(3-bromobenzoyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole? |
| A: InChIKey of 1-{[1-(3-bromobenzoyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole is BOJUZPZPZLCJNV-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-{[1-(3-bromobenzoyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole? |
| A: Molecular formula of 1-{[1-(3-bromobenzoyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole is C16H18BrN3O. |
| Q: What is the molecular weight of 1-{[1-(3-bromobenzoyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole? |
| A: Molecular weight of 1-{[1-(3-bromobenzoyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole is 348.24. |