1-{[1-(3-chloro-4-methoxybenzenesulfonyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole
Modify Date: 2025-11-04 18:52:24
![1-{[1-(3-chloro-4-methoxybenzenesulfonyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole Structure](https://www.chemsrc.com/extcaspic/072/2742056-49-9.png)
1-{[1-(3-chloro-4-methoxybenzenesulfonyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole structure
|
Common Name | 1-{[1-(3-chloro-4-methoxybenzenesulfonyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole | ||
|---|---|---|---|---|
| CAS Number | 2742056-49-9 | Molecular Weight | 369.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20ClN3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-{[1-(3-chloro-4-methoxybenzenesulfonyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H20ClN3O3S |
|---|---|
| Molecular Weight | 369.9 |
| InChIKey | LLJQQGUJHUYFDT-UHFFFAOYSA-N |
| SMILES | CCc1nccn1CC1CN(S(=O)(=O)c2ccc(OC)c(Cl)c2)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1-{[1-(3-chloro-4-methoxybenzenesulfonyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole? |
| A: Molecular formula of 1-{[1-(3-chloro-4-methoxybenzenesulfonyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole is C16H20ClN3O3S. |
| Q: What is the molecular weight of 1-{[1-(3-chloro-4-methoxybenzenesulfonyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole? |
| A: Molecular weight of 1-{[1-(3-chloro-4-methoxybenzenesulfonyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole is 369.9. |
| Q: What is the Chinese name of 2742056-49-9? |
| A: Chinese name of 2742056-49-9 is 2742056-49-9. |
| Q: What is the InChIKey of 1-{[1-(3-chloro-4-methoxybenzenesulfonyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole? |
| A: InChIKey of 1-{[1-(3-chloro-4-methoxybenzenesulfonyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole is LLJQQGUJHUYFDT-UHFFFAOYSA-N. |
| Q: What is the English name of 1-{[1-(3-chloro-4-methoxybenzenesulfonyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole? |
| A: The English name of 1-{[1-(3-chloro-4-methoxybenzenesulfonyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole is 1-{[1-(3-chloro-4-methoxybenzenesulfonyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole. |
| Q: What is the SMILES notation of 1-{[1-(3-chloro-4-methoxybenzenesulfonyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole? |
| A: SMILES notation of 1-{[1-(3-chloro-4-methoxybenzenesulfonyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole is CCc1nccn1CC1CN(S(=O)(=O)c2ccc(OC)c(Cl)c2)C1. |
| Q: What is the CAS number of 1-{[1-(3-chloro-4-methoxybenzenesulfonyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole? |
| A: CAS number of 1-{[1-(3-chloro-4-methoxybenzenesulfonyl)azetidin-3-yl]methyl}-2-ethyl-1H-imidazole is 2742056-49-9. |