2,7-dimethyl-2,3,7,8-tetrahydropyrano[4,3-b]pyran-4,5-dione structure
|
Common Name | 2,7-dimethyl-2,3,7,8-tetrahydropyrano[4,3-b]pyran-4,5-dione | ||
|---|---|---|---|---|
| CAS Number | 27424-77-7 | Molecular Weight | 196.20000 | |
| Density | 1.24g/cm3 | Boiling Point | 346.4ºC at 760mmHg | |
| Molecular Formula | C10H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.7ºC | |
| Name | 2,7-dimethyl-2,3,7,8-tetrahydropyrano[4,3-b]pyran-4,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 346.4ºC at 760mmHg |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20000 |
| Flash Point | 155.7ºC |
| Exact Mass | 196.07400 |
| PSA | 52.60000 |
| LogP | 0.95380 |
| Vapour Pressure | 5.76E-05mmHg at 25°C |
| Index of Refraction | 1.513 |
| InChIKey | AXIUGULHBQFQIU-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C(=O)CC(C)O2)C(=O)O1 |
|
~66%
2,7-dimethyl-2,... CAS#:27424-77-7 |
| Literature: Chantegrel, Bernard; Nadi, Abdel-Ilah; Gelin, Suzanne Journal of Heterocyclic Chemistry, 1984 , vol. 21, # 1 p. 13 - 16 |
|
~%
2,7-dimethyl-2,... CAS#:27424-77-7 |
| Literature: Chantegrel, Bernard; Nadi, Abdel-Ilah; Gelin, Suzanne Journal of Heterocyclic Chemistry, 1984 , vol. 21, # 1 p. 13 - 16 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,7-dimethyl-2,3,7,8-tetrahydro-4H,5H-pyrano[4,3-b]pyran-4,5-dione |
| 2,7-dimethyl-2,3,7,8-tetrahydro-pyrano[4,3-b]pyran-4,5-dione |
| 2,7-Dimethyl-2,3,4,5,7,8-hexahydropyrano(4,3-b)pyran-4,5-dione |
| 2,3,7,8-Tetrahydro-2,7-dimethyl-4H,5H-pyrano-<4,3-b>-pyran-4,5-dion |
| 2,3,7,8-Tetraidro-2,7-dimetil-4H,5H-pirano(4,3-b)piran-4,5-dione [Italian] |
| 4H,5H-Pyrano(4,3-b)pyran-4,5-dione,2,3,7,8-tetrahydro-2,7-dimethyl |