6-bromo-9-methoxy-2,3,4,5-tetrahydro-1H-3-benzazepine hydrochloride structure
|
Common Name | 6-bromo-9-methoxy-2,3,4,5-tetrahydro-1H-3-benzazepine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2742659-78-3 | Molecular Weight | 292.60 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15BrClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-bromo-9-methoxy-2,3,4,5-tetrahydro-1H-3-benzazepine hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H15BrClNO |
|---|---|
| Molecular Weight | 292.60 |
| InChIKey | FEWIKGMJJFXRAL-UHFFFAOYSA-N |
| SMILES | COc1ccc(Br)c2c1CCNCC2.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2742659-78-3? |
| A: Chinese name of 2742659-78-3 is 2742659-78-3. |
| Q: What is the English name of 6-bromo-9-methoxy-2,3,4,5-tetrahydro-1H-3-benzazepine hydrochloride? |
| A: The English name of 6-bromo-9-methoxy-2,3,4,5-tetrahydro-1H-3-benzazepine hydrochloride is 6-bromo-9-methoxy-2,3,4,5-tetrahydro-1H-3-benzazepine hydrochloride. |
| Q: What is the molecular formula of 6-bromo-9-methoxy-2,3,4,5-tetrahydro-1H-3-benzazepine hydrochloride? |
| A: Molecular formula of 6-bromo-9-methoxy-2,3,4,5-tetrahydro-1H-3-benzazepine hydrochloride is C11H15BrClNO. |
| Q: What is the CAS number of 6-bromo-9-methoxy-2,3,4,5-tetrahydro-1H-3-benzazepine hydrochloride? |
| A: CAS number of 6-bromo-9-methoxy-2,3,4,5-tetrahydro-1H-3-benzazepine hydrochloride is 2742659-78-3. |
| Q: What is the molecular weight of 6-bromo-9-methoxy-2,3,4,5-tetrahydro-1H-3-benzazepine hydrochloride? |
| A: Molecular weight of 6-bromo-9-methoxy-2,3,4,5-tetrahydro-1H-3-benzazepine hydrochloride is 292.60. |
| Q: What is the SMILES notation of 6-bromo-9-methoxy-2,3,4,5-tetrahydro-1H-3-benzazepine hydrochloride? |
| A: SMILES notation of 6-bromo-9-methoxy-2,3,4,5-tetrahydro-1H-3-benzazepine hydrochloride is COc1ccc(Br)c2c1CCNCC2.Cl. |
| Q: What is the InChIKey of 6-bromo-9-methoxy-2,3,4,5-tetrahydro-1H-3-benzazepine hydrochloride? |
| A: InChIKey of 6-bromo-9-methoxy-2,3,4,5-tetrahydro-1H-3-benzazepine hydrochloride is FEWIKGMJJFXRAL-UHFFFAOYSA-N. |