3-hydroxy-1,2,4-benzotriazine 1-oxide
3-hydroxy-1,2,4-benzotriazine 1-oxide structure
|
Common Name | 3-hydroxy-1,2,4-benzotriazine 1-oxide | ||
|---|---|---|---|---|
| CAS Number | 27446-08-8 | Molecular Weight | 163.13300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H5N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-hydroxy-1,2,4-benzotriazine 1-oxide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H5N3O2 |
|---|---|
| Molecular Weight | 163.13300 |
| Exact Mass | 163.03800 |
| PSA | 71.47000 |
| LogP | 0.76390 |
| InChIKey | GXEKFJODJPFJPG-UHFFFAOYSA-N |
| SMILES | O=c1nc2ccccc2[n+]([O-])[nH]1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 7 | |
CAS#:1016-90-6
CAS#:5424-06-6
CAS#:27314-97-2
CAS#:67692-91-5![2-[(10-oxido-8-oxo-7,9-diaza-10-azoniabicyclo[4.4.0]deca-1,3,5,9-tetraen-7-yl)methoxy]ethyl acetate structure](https://image.chemsrc.com/caspic/464/83702-30-1.png)
CAS#:83702-30-1![1,2,4-Benzotriazin-3(4H)-one,4-[(2-hydroxyethoxy)methyl]-, 1-oxide structure](https://image.chemsrc.com/caspic/388/83702-32-3.png)
CAS#:83702-32-3
CAS#:59323-44-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-Hydroxy-1,2,4-benzotriazin-1-oxid |
| 1,2,4-Benzotriazin-3-ol 1-oxide |
| 1,2,4-benzotriazin-3-ol 1-oxide |
| 3-hydroxy-1,2,4-benzotriazine-1-oxide |
| benzo[e][1,2,4]triazine-2-hydroxy-1-oxide |
| 1-oxy-4H-benzo[1,2,4]triazin-3-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-hydroxy-1,2,4-benzotriazine 1-oxide? |
| A: InChIKey of 3-hydroxy-1,2,4-benzotriazine 1-oxide is GXEKFJODJPFJPG-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3-hydroxy-1,2,4-benzotriazine 1-oxide? |
| A: Molecular formula of 3-hydroxy-1,2,4-benzotriazine 1-oxide is C7H5N3O2. |
| Q: What is the SMILES notation of 3-hydroxy-1,2,4-benzotriazine 1-oxide? |
| A: SMILES notation of 3-hydroxy-1,2,4-benzotriazine 1-oxide is O=c1nc2ccccc2[n+]([O-])[nH]1. |
| Q: What are the downstream products of 3-hydroxy-1,2,4-benzotriazine 1-oxide? |
| A: Related downstream products(CAS) of 3-hydroxy-1,2,4-benzotriazine 1-oxide: 1016-90-6;5424-06-6;27314-97-2;67692-91-5;83702-30-1;83702-32-3;59323-44-3. |
| Q: What is the polar surface area (PSA) of 3-hydroxy-1,2,4-benzotriazine 1-oxide? |
| A: Polar surface area (PSA) of 3-hydroxy-1,2,4-benzotriazine 1-oxide is 71.47000. |
| Q: What is the Chinese name of 27446-08-8? |
| A: Chinese name of 27446-08-8 is 27446-08-8. |
| Q: What is the English name of 3-hydroxy-1,2,4-benzotriazine 1-oxide? |
| A: The English name of 3-hydroxy-1,2,4-benzotriazine 1-oxide is 3-hydroxy-1,2,4-benzotriazine 1-oxide. |
| Q: What is the CAS number of 3-hydroxy-1,2,4-benzotriazine 1-oxide? |
| A: CAS number of 3-hydroxy-1,2,4-benzotriazine 1-oxide is 27446-08-8. |
| Q: What is the LogP of 3-hydroxy-1,2,4-benzotriazine 1-oxide? |
| A: LogP of 3-hydroxy-1,2,4-benzotriazine 1-oxide is 0.76390. |
| Q: What English synonyms does 3-hydroxy-1,2,4-benzotriazine 1-oxide have? |
| A: English synonyms of 3-hydroxy-1,2,4-benzotriazine 1-oxide: 3-Hydroxy-1,2,4-benzotriazin-1-oxid, 1,2,4-Benzotriazin-3-ol 1-oxide, 1,2,4-benzotriazin-3-ol 1-oxide, 3-hydroxy-1,2,4-benzotriazine-1-oxide, benzo[e][1,2,4]triazine-2-hydroxy-1-oxide, 1-oxy-4H-benzo[1,2,4]triazin-3-one. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |