chromone-2-carbohydroxamic acid structure
|
Common Name | chromone-2-carbohydroxamic acid | ||
|---|---|---|---|---|
| CAS Number | 27455-32-9 | Molecular Weight | 205.16700 | |
| Density | 1.506g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H7NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-hydroxy-4-oxochromene-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.506g/cm3 |
|---|---|
| Molecular Formula | C10H7NO4 |
| Molecular Weight | 205.16700 |
| Exact Mass | 205.03800 |
| PSA | 79.54000 |
| LogP | 1.30290 |
| Index of Refraction | 1.646 |
| InChIKey | LNEZENXSHJBCFL-UHFFFAOYSA-N |
| SMILES | O=C(NO)c1cc(=O)c2ccccc2o1 |
| HS Code | 2924199090 |
|---|
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4H-1-Benzopyran-2-carboxamide,N-hydroxy-4-oxo |
| Chromone-2-carbohydroxamic acid |
| 4H-1-Benzopyran-2-carbohydroxamicacid,4-oxo-(8CI) |