N,N-dimethyl-4-aminoazobenzene N-oxide structure
|
Common Name | N,N-dimethyl-4-aminoazobenzene N-oxide | ||
|---|---|---|---|---|
| CAS Number | 2747-31-1 | Molecular Weight | 241.28800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N-dimethyl-4-phenyldiazenylbenzeneamine oxide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H15N3O |
|---|---|
| Molecular Weight | 241.28800 |
| Exact Mass | 241.12200 |
| PSA | 54.15000 |
| LogP | 4.20150 |
| InChIKey | XHTVNOLAJVJNLK-UHFFFAOYSA-N |
| SMILES | C[N+](C)([O-])c1ccc(N=Nc2ccccc2)cc1 |
| HS Code | 2927000090 |
|---|
|
~79%
N,N-dimethyl-4-... CAS#:2747-31-1 |
| Literature: Pentimalli, Luciano; Milani, Giovanni Gazzetta Chimica Italiana, 1984 , vol. 114, # 11/12 p. 529 - 532 |
|
~70%
N,N-dimethyl-4-... CAS#:2747-31-1 |
| Literature: Albini, Angelo; Fasani, Elisa; Moroni, Micaela; Pietra, Silvio Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1986 , p. 1439 - 1444 |
|
~%
N,N-dimethyl-4-... CAS#:2747-31-1 |
| Literature: Albini, Angelo; Fasani, Elisa; Moroni, Micaela; Pietra, Silvio Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1986 , p. 1439 - 1444 |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-(phenylazo)-N,N-dimethylaniline amino oxide |
| 4-Dimethylaminoazobenzene amine N-oxide |
| ANILINE,N,N-DIMETHYL-p-PHENYLAZO-,N-OXIDE |
| N,N-Dimethylaminoazobenzene-N-oxide |
| Buttergelb-N-oxid |
| p-Dimethylamino-azobenzol-aminoxid |
| N,N-Dimethyl-p-phenylazo-anilin-N-oxid |
| Dab-N-oxide |
| N,N-Dimethyl-4-aminoazobenzene N-oxide |
| N,N-Dimethyl-p-phenylazoaniline-N-oxide |
| N,N-dimethyl-4-phenylazoaniline N-oxide |