2-({[6-(Trifluoromethyl)pyridin-3-yl]oxy}methyl)morpholine
Modify Date: 2025-09-14 19:24:52
![2-({[6-(Trifluoromethyl)pyridin-3-yl]oxy}methyl)morpholine Structure](https://www.chemsrc.com/extcaspic/233/2748357-98-2.png)
2-({[6-(Trifluoromethyl)pyridin-3-yl]oxy}methyl)morpholine structure
|
Common Name | 2-({[6-(Trifluoromethyl)pyridin-3-yl]oxy}methyl)morpholine | ||
|---|---|---|---|---|
| CAS Number | 2748357-98-2 | Molecular Weight | 262.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13F3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-({[6-(Trifluoromethyl)pyridin-3-yl]oxy}methyl)morpholine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H13F3N2O2 |
|---|---|
| Molecular Weight | 262.23 |
| InChIKey | USTQZRQAQNPRAA-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc(OCC2CNCCO2)cn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-({[6-(Trifluoromethyl)pyridin-3-yl]oxy}methyl)morpholine? |
| A: The English name of 2-({[6-(Trifluoromethyl)pyridin-3-yl]oxy}methyl)morpholine is 2-({[6-(Trifluoromethyl)pyridin-3-yl]oxy}methyl)morpholine. |
| Q: What is the InChIKey of 2-({[6-(Trifluoromethyl)pyridin-3-yl]oxy}methyl)morpholine? |
| A: InChIKey of 2-({[6-(Trifluoromethyl)pyridin-3-yl]oxy}methyl)morpholine is USTQZRQAQNPRAA-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-({[6-(Trifluoromethyl)pyridin-3-yl]oxy}methyl)morpholine? |
| A: CAS number of 2-({[6-(Trifluoromethyl)pyridin-3-yl]oxy}methyl)morpholine is 2748357-98-2. |
| Q: What is the molecular weight of 2-({[6-(Trifluoromethyl)pyridin-3-yl]oxy}methyl)morpholine? |
| A: Molecular weight of 2-({[6-(Trifluoromethyl)pyridin-3-yl]oxy}methyl)morpholine is 262.23. |
| Q: What is the SMILES notation of 2-({[6-(Trifluoromethyl)pyridin-3-yl]oxy}methyl)morpholine? |
| A: SMILES notation of 2-({[6-(Trifluoromethyl)pyridin-3-yl]oxy}methyl)morpholine is FC(F)(F)c1ccc(OCC2CNCCO2)cn1. |
| Q: What is the molecular formula of 2-({[6-(Trifluoromethyl)pyridin-3-yl]oxy}methyl)morpholine? |
| A: Molecular formula of 2-({[6-(Trifluoromethyl)pyridin-3-yl]oxy}methyl)morpholine is C11H13F3N2O2. |
| Q: What is the Chinese name of 2748357-98-2? |
| A: Chinese name of 2748357-98-2 is 2748357-98-2. |