L-Cysteine,S-(1-naphthalenyldiphenylmethyl)- structure
|
Common Name | L-Cysteine,S-(1-naphthalenyldiphenylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 27486-76-6 | Molecular Weight | 413.53100 | |
| Density | 1.256g/cm3 | Boiling Point | 599ºC at 760mmHg | |
| Molecular Formula | C26H23NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 316.1ºC | |
| Name | S-(naphthalen-1-yldiphenylmethyl)cysteine |
|---|
| Density | 1.256g/cm3 |
|---|---|
| Boiling Point | 599ºC at 760mmHg |
| Molecular Formula | C26H23NO2S |
| Molecular Weight | 413.53100 |
| Flash Point | 316.1ºC |
| Exact Mass | 413.14500 |
| PSA | 88.62000 |
| LogP | 5.97710 |
| Vapour Pressure | 3.37E-15mmHg at 25°C |
| Index of Refraction | 1.679 |
| InChIKey | WUEMKWIMYPFRNV-UHFFFAOYSA-N |
| SMILES | NC(CSC(c1ccccc1)(c1ccccc1)c1cccc2ccccc12)C(=O)O |
|
~%
L-Cysteine,S-(1... CAS#:27486-76-6 |
| Literature: Zee-Cheng,K.-Y.; Cheng,C.C. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 414 - 418 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |