3-(azetidin-3-yl)-4-(1-phenylethyl)-4H-1,2,4-triazole
Modify Date: 2026-09-28 19:36:15
3-(azetidin-3-yl)-4-(1-phenylethyl)-4H-1,2,4-triazole structure
|
Common Name | 3-(azetidin-3-yl)-4-(1-phenylethyl)-4H-1,2,4-triazole | ||
|---|---|---|---|---|
| CAS Number | 2748605-13-0 | Molecular Weight | 228.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(azetidin-3-yl)-4-(1-phenylethyl)-4H-1,2,4-triazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16N4 |
|---|---|
| Molecular Weight | 228.29 |
| InChIKey | KFNGGIQKUNMQFW-UHFFFAOYSA-N |
| SMILES | CC(c1ccccc1)n1cnnc1C1CNC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3-(azetidin-3-yl)-4-(1-phenylethyl)-4H-1,2,4-triazole? |
| A: The English name of 3-(azetidin-3-yl)-4-(1-phenylethyl)-4H-1,2,4-triazole is 3-(azetidin-3-yl)-4-(1-phenylethyl)-4H-1,2,4-triazole. |
| Q: What is the SMILES notation of 3-(azetidin-3-yl)-4-(1-phenylethyl)-4H-1,2,4-triazole? |
| A: SMILES notation of 3-(azetidin-3-yl)-4-(1-phenylethyl)-4H-1,2,4-triazole is CC(c1ccccc1)n1cnnc1C1CNC1. |
| Q: What is the molecular weight of 3-(azetidin-3-yl)-4-(1-phenylethyl)-4H-1,2,4-triazole? |
| A: Molecular weight of 3-(azetidin-3-yl)-4-(1-phenylethyl)-4H-1,2,4-triazole is 228.29. |
| Q: What is the InChIKey of 3-(azetidin-3-yl)-4-(1-phenylethyl)-4H-1,2,4-triazole? |
| A: InChIKey of 3-(azetidin-3-yl)-4-(1-phenylethyl)-4H-1,2,4-triazole is KFNGGIQKUNMQFW-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2748605-13-0? |
| A: Chinese name of 2748605-13-0 is 2748605-13-0. |
| Q: What is the CAS number of 3-(azetidin-3-yl)-4-(1-phenylethyl)-4H-1,2,4-triazole? |
| A: CAS number of 3-(azetidin-3-yl)-4-(1-phenylethyl)-4H-1,2,4-triazole is 2748605-13-0. |
| Q: What is the molecular formula of 3-(azetidin-3-yl)-4-(1-phenylethyl)-4H-1,2,4-triazole? |
| A: Molecular formula of 3-(azetidin-3-yl)-4-(1-phenylethyl)-4H-1,2,4-triazole is C13H16N4. |