[1,1-Biphenyl]-2,4-diol,5-bromo-(9CI) structure
|
Common Name | [1,1-Biphenyl]-2,4-diol,5-bromo-(9CI) | ||
|---|---|---|---|---|
| CAS Number | 27489-14-1 | Molecular Weight | 265.10300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-bromo-6-phenylbenzene-1,3-diol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H9BrO2 |
|---|---|
| Molecular Weight | 265.10300 |
| Exact Mass | 263.97900 |
| PSA | 40.46000 |
| LogP | 3.52730 |
| InChIKey | CDNIWJHGJLNDQO-UHFFFAOYSA-N |
| SMILES | Oc1cc(O)c(-c2ccccc2)cc1Br |
| HS Code | 2907299090 |
|---|
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| [1,1-biphenyl]-2,4-diol,5-bromo |