1-Phenyl-2-(pyrrolidin-1-yl)octan-1-one,monohydrochloride
Modify Date: 2026-08-12 21:40:07
1-Phenyl-2-(pyrrolidin-1-yl)octan-1-one,monohydrochloride structure
|
Common Name | 1-Phenyl-2-(pyrrolidin-1-yl)octan-1-one,monohydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2749897-19-4 | Molecular Weight | 309.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H28ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Phenyl-2-(pyrrolidin-1-yl)octan-1-one,monohydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H28ClNO |
|---|---|
| Molecular Weight | 309.9 |
| InChIKey | IMDZZHFIOSIZRR-UHFFFAOYSA-N |
| SMILES | CCCCCCC(C(=O)c1ccccc1)N1CCCC1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-Phenyl-2-(pyrrolidin-1-yl)octan-1-one,monohydrochloride? |
| A: InChIKey of 1-Phenyl-2-(pyrrolidin-1-yl)octan-1-one,monohydrochloride is IMDZZHFIOSIZRR-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-Phenyl-2-(pyrrolidin-1-yl)octan-1-one,monohydrochloride? |
| A: SMILES notation of 1-Phenyl-2-(pyrrolidin-1-yl)octan-1-one,monohydrochloride is CCCCCCC(C(=O)c1ccccc1)N1CCCC1.Cl. |
| Q: What is the molecular weight of 1-Phenyl-2-(pyrrolidin-1-yl)octan-1-one,monohydrochloride? |
| A: Molecular weight of 1-Phenyl-2-(pyrrolidin-1-yl)octan-1-one,monohydrochloride is 309.9. |
| Q: What is the molecular formula of 1-Phenyl-2-(pyrrolidin-1-yl)octan-1-one,monohydrochloride? |
| A: Molecular formula of 1-Phenyl-2-(pyrrolidin-1-yl)octan-1-one,monohydrochloride is C18H28ClNO. |
| Q: What is the CAS number of 1-Phenyl-2-(pyrrolidin-1-yl)octan-1-one,monohydrochloride? |
| A: CAS number of 1-Phenyl-2-(pyrrolidin-1-yl)octan-1-one,monohydrochloride is 2749897-19-4. |
| Q: What is the Chinese name of 2749897-19-4? |
| A: Chinese name of 2749897-19-4 is 2749897-19-4. |
| Q: What is the English name of 1-Phenyl-2-(pyrrolidin-1-yl)octan-1-one,monohydrochloride? |
| A: The English name of 1-Phenyl-2-(pyrrolidin-1-yl)octan-1-one,monohydrochloride is 1-Phenyl-2-(pyrrolidin-1-yl)octan-1-one,monohydrochloride. |