rifamide structure
|
Common Name | rifamide | ||
|---|---|---|---|---|
| CAS Number | 2750-76-7 | Molecular Weight | 810.92600 | |
| Density | 1.3g/cm3 | Boiling Point | 927.4ºC at 760mmHg | |
| Molecular Formula | C43H58N2O13 | Melting Point | 170°C (rough estimate) | |
| MSDS | N/A | Flash Point | 514.7ºC | |
| Name | Rifampicin M/14 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 927.4ºC at 760mmHg |
| Melting Point | 170°C (rough estimate) |
| Molecular Formula | C43H58N2O13 |
| Molecular Weight | 810.92600 |
| Flash Point | 514.7ºC |
| Exact Mass | 810.39400 |
| PSA | 210.62000 |
| LogP | 5.43370 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | VFYNXKZVOUXHDX-VDPUEHCXSA-N |
| SMILES | CCN(CC)C(=O)COc1cc2c(O)c3c(O)c(C)c4c(c13)C(=O)C(C)(OC=CC(OC)C(C)C(OC(C)=O)C(C)C(O)C(C)C(O)C(C)C=CC=C(C)C(=O)N2)O4 |
|
~%
rifamide CAS#:2750-76-7 |
| Literature: Sensi,P. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 596 - 602 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Rifomycin B diethylamide |
| N,N-Diethylrifamycin B amide |
| rifamycin-B diethylamide |
| Rifocin M |
| rifamycin-M-14 |
| Rifamycin-B-diaethylamid |
| Rifocina M |
| Rifomycin M14 |
| RIFAMIDE |
| RF M-14 |