2-Methyl-1H-benzimidazole-6-sulfonic acid
Modify Date: 2026-06-26 17:07:19
2-Methyl-1H-benzimidazole-6-sulfonic acid structure
|
Common Name | 2-Methyl-1H-benzimidazole-6-sulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 27503-79-3 | Molecular Weight | 212.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Methyl-1H-benzimidazole-6-sulfonic acid |
|---|
| Molecular Formula | C8H8N2O3S |
|---|---|
| Molecular Weight | 212.23 |
| InChIKey | SKHIUCCKYNPWLU-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1)C=C(C=C2)S(=O)(=O)O |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
Total 1, Current Page 1 of 1
1