(2S)-2,6-dichloro-N-(2,6-dimethylphenyl)hexanamide
Modify Date: 2026-06-30 19:34:23
(2S)-2,6-dichloro-N-(2,6-dimethylphenyl)hexanamide structure
|
Common Name | (2S)-2,6-dichloro-N-(2,6-dimethylphenyl)hexanamide | ||
|---|---|---|---|---|
| CAS Number | 2751623-55-7 | Molecular Weight | 288.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2S)-2,6-dichloro-N-(2,6-dimethylphenyl)hexanamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H19Cl2NO |
|---|---|
| Molecular Weight | 288.2 |
| InChIKey | JHPMUNZBGKBWPW-LBPRGKRZSA-N |
| SMILES | Cc1cccc(C)c1NC(=O)C(Cl)CCCCCl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (2S)-2,6-dichloro-N-(2,6-dimethylphenyl)hexanamide? |
| A: InChIKey of (2S)-2,6-dichloro-N-(2,6-dimethylphenyl)hexanamide is JHPMUNZBGKBWPW-LBPRGKRZSA-N. |
| Q: What is the Chinese name of 2751623-55-7? |
| A: Chinese name of 2751623-55-7 is 2751623-55-7. |
| Q: What is the molecular formula of (2S)-2,6-dichloro-N-(2,6-dimethylphenyl)hexanamide? |
| A: Molecular formula of (2S)-2,6-dichloro-N-(2,6-dimethylphenyl)hexanamide is C14H19Cl2NO. |
| Q: What is the CAS number of (2S)-2,6-dichloro-N-(2,6-dimethylphenyl)hexanamide? |
| A: CAS number of (2S)-2,6-dichloro-N-(2,6-dimethylphenyl)hexanamide is 2751623-55-7. |
| Q: What is the English name of (2S)-2,6-dichloro-N-(2,6-dimethylphenyl)hexanamide? |
| A: The English name of (2S)-2,6-dichloro-N-(2,6-dimethylphenyl)hexanamide is (2S)-2,6-dichloro-N-(2,6-dimethylphenyl)hexanamide. |
| Q: What is the SMILES notation of (2S)-2,6-dichloro-N-(2,6-dimethylphenyl)hexanamide? |
| A: SMILES notation of (2S)-2,6-dichloro-N-(2,6-dimethylphenyl)hexanamide is Cc1cccc(C)c1NC(=O)C(Cl)CCCCCl. |
| Q: What is the molecular weight of (2S)-2,6-dichloro-N-(2,6-dimethylphenyl)hexanamide? |
| A: Molecular weight of (2S)-2,6-dichloro-N-(2,6-dimethylphenyl)hexanamide is 288.2. |