(S)-1-(2-phenylacetyl)pyrrolidine-2-carboxylic acid structure
|
Common Name | (S)-1-(2-phenylacetyl)pyrrolidine-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2752-38-7 | Molecular Weight | 233.26300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (S)-1-(2-phenylacetyl)pyrrolidine-2-carboxylicacid |
|---|
| Molecular Formula | C13H15NO3 |
|---|---|
| Molecular Weight | 233.26300 |
| Exact Mass | 233.10500 |
| PSA | 57.61000 |
| LogP | 1.24260 |
| Vapour Pressure | 1.28E-09mmHg at 25°C |
| InChIKey | UBQCWSGRNIOFFC-NSHDSACASA-N |
| SMILES | O=C(O)C1CCCN1C(=O)Cc1ccccc1 |
| HS Code | 2933990090 |
|---|
|
~%
(S)-1-(2-phenyl... CAS#:2752-38-7 |
| Literature: Pfeiffer; Chambers; Hilbert; Woodward; Ackerman Journal of Medicinal Chemistry, 1984 , vol. 27, # 3 p. 325 - 341 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |