2-benzamido-3-(3,4-dimethoxyphenyl)prop-2-enoic acid structure
|
Common Name | 2-benzamido-3-(3,4-dimethoxyphenyl)prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 2755-06-8 | Molecular Weight | 327.33100 | |
| Density | 1.27g/cm3 | Boiling Point | 578.9ºC at 760 mmHg | |
| Molecular Formula | C18H17NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303.9ºC | |
| Name | 2-benzamido-3-(3,4-dimethoxyphenyl)prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 578.9ºC at 760 mmHg |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.33100 |
| Flash Point | 303.9ºC |
| Exact Mass | 327.11100 |
| PSA | 84.86000 |
| LogP | 2.95020 |
| Vapour Pressure | 3.03E-14mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | ZVYAMCIAGJJMOW-GXDHUFHOSA-N |
| SMILES | COc1ccc(C=C(NC(=O)c2ccccc2)C(=O)O)cc1OC |
|
~%
2-benzamido-3-(... CAS#:2755-06-8 |
| Literature: Butterick; Unrau Canadian Journal of Chemistry, 1974 , vol. 52, # 16 p. 2873 - 2879 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-benzoyl-glutaric acid diethyl ester |
| 2-Benzoyl-glutarsaeureimid |
| N-Benzoyl-<3,4-dimethoxy-benzyliden>-glycin |
| 3-benzoylamino-piperidine-2,6-dione |
| 2-Benzoyl-glutarsaeure-diaethylester |
| Pentanedioic acid,2-benzoyl-,1,5-diethyl ester |