3-Thiazolidineaceticacid, 5-[(5-nitro-2-furanyl)methylene]-2,4-dioxo-, ethyl ester structure
|
Common Name | 3-Thiazolidineaceticacid, 5-[(5-nitro-2-furanyl)methylene]-2,4-dioxo-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 27550-27-2 | Molecular Weight | 326.28200 | |
| Density | 1.563g/cm3 | Boiling Point | 478.9ºC at 760 mmHg | |
| Molecular Formula | C12H10N2O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.4ºC | |
| Name | ethyl 2-[5-[(5-nitrofuran-2-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|
| Density | 1.563g/cm3 |
|---|---|
| Boiling Point | 478.9ºC at 760 mmHg |
| Molecular Formula | C12H10N2O7S |
| Molecular Weight | 326.28200 |
| Flash Point | 243.4ºC |
| Exact Mass | 326.02100 |
| PSA | 147.94000 |
| LogP | 2.24830 |
| Vapour Pressure | 2.47E-09mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | CCMMTNSDHSJGCG-VMPITWQZSA-N |
| SMILES | CCOC(=O)CN1C(=O)SC(=Cc2ccc([N+](=O)[O-])o2)C1=O |
|
~%
3-Thiazolidinea... CAS#:27550-27-2 |
| Literature: Akerblom Journal of Medicinal Chemistry, 1974 , vol. 17, # 7 p. 756 - 758 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |