2,4,5,6(1H,3H)-Pyrimidinetetrone,1,3-dimethyl- structure
|
Common Name | 2,4,5,6(1H,3H)-Pyrimidinetetrone,1,3-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 2757-85-9 | Molecular Weight | 170.12300 | |
| Density | 1.485g/cm3 | Boiling Point | 247.7ºC at 760mmHg | |
| Molecular Formula | C6H6N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 108ºC | |
| Name | 1,3-dimethyl-1,3-diazinane-2,4,5,6-tetrone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.485g/cm3 |
|---|---|
| Boiling Point | 247.7ºC at 760mmHg |
| Molecular Formula | C6H6N2O4 |
| Molecular Weight | 170.12300 |
| Flash Point | 108ºC |
| Exact Mass | 170.03300 |
| PSA | 74.76000 |
| Vapour Pressure | 0.0253mmHg at 25°C |
| Index of Refraction | 1.532 |
| InChIKey | KUCNNTLJQCDKEI-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(=O)C(=O)N(C)C1=O |
| HS Code | 2933599090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 7 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-Dimethylalloxan |
| 1,3-dimethylpyrimidine-2,4,5,6(1h,3h)-tetrone |
| 1,3-dimethylpyrimidine-2,4,5,6(1H,3H)-tetraone |
| 1,3-dimethylhexahydro-2,4,5,6-pyrimidinetetraone |
| 1,3-dimethylalloxane |