(6,6-Dimethyloxan-2-yl)methyl 4-methylbenzene-1-sulfonate
Modify Date: 2026-09-27 17:02:24
(6,6-Dimethyloxan-2-yl)methyl 4-methylbenzene-1-sulfonate structure
|
Common Name | (6,6-Dimethyloxan-2-yl)methyl 4-methylbenzene-1-sulfonate | ||
|---|---|---|---|---|
| CAS Number | 2757891-04-4 | Molecular Weight | 298.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H22O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (6,6-Dimethyloxan-2-yl)methyl 4-methylbenzene-1-sulfonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H22O4S |
|---|---|
| Molecular Weight | 298.4 |
| InChIKey | KZKSNNRVWMOVNA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CCCC(C)(C)O2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (6,6-Dimethyloxan-2-yl)methyl 4-methylbenzene-1-sulfonate? |
| A: The English name of (6,6-Dimethyloxan-2-yl)methyl 4-methylbenzene-1-sulfonate is (6,6-Dimethyloxan-2-yl)methyl 4-methylbenzene-1-sulfonate. |
| Q: What is the InChIKey of (6,6-Dimethyloxan-2-yl)methyl 4-methylbenzene-1-sulfonate? |
| A: InChIKey of (6,6-Dimethyloxan-2-yl)methyl 4-methylbenzene-1-sulfonate is KZKSNNRVWMOVNA-UHFFFAOYSA-N. |
| Q: What is the CAS number of (6,6-Dimethyloxan-2-yl)methyl 4-methylbenzene-1-sulfonate? |
| A: CAS number of (6,6-Dimethyloxan-2-yl)methyl 4-methylbenzene-1-sulfonate is 2757891-04-4. |
| Q: What is the SMILES notation of (6,6-Dimethyloxan-2-yl)methyl 4-methylbenzene-1-sulfonate? |
| A: SMILES notation of (6,6-Dimethyloxan-2-yl)methyl 4-methylbenzene-1-sulfonate is Cc1ccc(S(=O)(=O)OCC2CCCC(C)(C)O2)cc1. |
| Q: What is the molecular weight of (6,6-Dimethyloxan-2-yl)methyl 4-methylbenzene-1-sulfonate? |
| A: Molecular weight of (6,6-Dimethyloxan-2-yl)methyl 4-methylbenzene-1-sulfonate is 298.4. |
| Q: What is the Chinese name of 2757891-04-4? |
| A: Chinese name of 2757891-04-4 is 2757891-04-4. |
| Q: What is the molecular formula of (6,6-Dimethyloxan-2-yl)methyl 4-methylbenzene-1-sulfonate? |
| A: Molecular formula of (6,6-Dimethyloxan-2-yl)methyl 4-methylbenzene-1-sulfonate is C15H22O4S. |