2-[(4-{[(Benzyloxy)carbonyl]amino}phenyl)sulfanyl]acetic acid
Modify Date: 2025-09-22 08:35:16
![2-[(4-{[(Benzyloxy)carbonyl]amino}phenyl)sulfanyl]acetic acid Structure](https://www.chemsrc.com/extcaspic/464/2757928-65-5.png)
2-[(4-{[(Benzyloxy)carbonyl]amino}phenyl)sulfanyl]acetic acid structure
|
Common Name | 2-[(4-{[(Benzyloxy)carbonyl]amino}phenyl)sulfanyl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 2757928-65-5 | Molecular Weight | 317.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[(4-{[(Benzyloxy)carbonyl]amino}phenyl)sulfanyl]acetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H15NO4S |
|---|---|
| Molecular Weight | 317.4 |
| InChIKey | MFFBRQPXIXFMML-UHFFFAOYSA-N |
| SMILES | O=C(O)CSc1ccc(NC(=O)OCc2ccccc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-[(4-{[(Benzyloxy)carbonyl]amino}phenyl)sulfanyl]acetic acid? |
| A: SMILES notation of 2-[(4-{[(Benzyloxy)carbonyl]amino}phenyl)sulfanyl]acetic acid is O=C(O)CSc1ccc(NC(=O)OCc2ccccc2)cc1. |
| Q: What is the molecular formula of 2-[(4-{[(Benzyloxy)carbonyl]amino}phenyl)sulfanyl]acetic acid? |
| A: Molecular formula of 2-[(4-{[(Benzyloxy)carbonyl]amino}phenyl)sulfanyl]acetic acid is C16H15NO4S. |
| Q: What is the Chinese name of 2757928-65-5? |
| A: Chinese name of 2757928-65-5 is 2757928-65-5. |
| Q: What is the molecular weight of 2-[(4-{[(Benzyloxy)carbonyl]amino}phenyl)sulfanyl]acetic acid? |
| A: Molecular weight of 2-[(4-{[(Benzyloxy)carbonyl]amino}phenyl)sulfanyl]acetic acid is 317.4. |
| Q: What is the CAS number of 2-[(4-{[(Benzyloxy)carbonyl]amino}phenyl)sulfanyl]acetic acid? |
| A: CAS number of 2-[(4-{[(Benzyloxy)carbonyl]amino}phenyl)sulfanyl]acetic acid is 2757928-65-5. |
| Q: What is the English name of 2-[(4-{[(Benzyloxy)carbonyl]amino}phenyl)sulfanyl]acetic acid? |
| A: The English name of 2-[(4-{[(Benzyloxy)carbonyl]amino}phenyl)sulfanyl]acetic acid is 2-[(4-{[(Benzyloxy)carbonyl]amino}phenyl)sulfanyl]acetic acid. |
| Q: What is the InChIKey of 2-[(4-{[(Benzyloxy)carbonyl]amino}phenyl)sulfanyl]acetic acid? |
| A: InChIKey of 2-[(4-{[(Benzyloxy)carbonyl]amino}phenyl)sulfanyl]acetic acid is MFFBRQPXIXFMML-UHFFFAOYSA-N. |