Dicyclopropylmethyl 4-methylbenzene-1-sulfonate
Modify Date: 2026-07-01 16:42:17
Dicyclopropylmethyl 4-methylbenzene-1-sulfonate structure
|
Common Name | Dicyclopropylmethyl 4-methylbenzene-1-sulfonate | ||
|---|---|---|---|---|
| CAS Number | 2757951-19-0 | Molecular Weight | 266.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Dicyclopropylmethyl 4-methylbenzene-1-sulfonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H18O3S |
|---|---|
| Molecular Weight | 266.36 |
| InChIKey | JYZZFKFFFSGHFA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OC(C2CC2)C2CC2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Dicyclopropylmethyl 4-methylbenzene-1-sulfonate? |
| A: The English name of Dicyclopropylmethyl 4-methylbenzene-1-sulfonate is Dicyclopropylmethyl 4-methylbenzene-1-sulfonate. |
| Q: What is the SMILES notation of Dicyclopropylmethyl 4-methylbenzene-1-sulfonate? |
| A: SMILES notation of Dicyclopropylmethyl 4-methylbenzene-1-sulfonate is Cc1ccc(S(=O)(=O)OC(C2CC2)C2CC2)cc1. |
| Q: What is the CAS number of Dicyclopropylmethyl 4-methylbenzene-1-sulfonate? |
| A: CAS number of Dicyclopropylmethyl 4-methylbenzene-1-sulfonate is 2757951-19-0. |
| Q: What is the molecular formula of Dicyclopropylmethyl 4-methylbenzene-1-sulfonate? |
| A: Molecular formula of Dicyclopropylmethyl 4-methylbenzene-1-sulfonate is C14H18O3S. |
| Q: What is the InChIKey of Dicyclopropylmethyl 4-methylbenzene-1-sulfonate? |
| A: InChIKey of Dicyclopropylmethyl 4-methylbenzene-1-sulfonate is JYZZFKFFFSGHFA-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2757951-19-0? |
| A: Chinese name of 2757951-19-0 is 2757951-19-0. |
| Q: What is the molecular weight of Dicyclopropylmethyl 4-methylbenzene-1-sulfonate? |
| A: Molecular weight of Dicyclopropylmethyl 4-methylbenzene-1-sulfonate is 266.36. |