4-(2,4-dichlorophenoxy)butyric acid, compound with dimethylamine (1:1) structure
|
Common Name | 4-(2,4-dichlorophenoxy)butyric acid, compound with dimethylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 2758-42-1 | Molecular Weight | 294.17400 | |
| Density | N/A | Boiling Point | 410.4ºC at 760 mmHg | |
| Molecular Formula | C12H17Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202ºC | |
| Name | 2,4-DB-dimethylammonium |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 410.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C12H17Cl2NO3 |
| Molecular Weight | 294.17400 |
| Flash Point | 202ºC |
| Exact Mass | 293.05900 |
| PSA | 58.56000 |
| LogP | 3.46350 |
| Vapour Pressure | 1.8E-07mmHg at 25°C |
| InChIKey | KEIXJOCOXNOKHI-UHFFFAOYSA-N |
| SMILES | CNC.O=C(O)CCCOc1ccc(Cl)cc1Cl |
CHEMICAL IDENTIFICATION
|
| RIDADR | UN 2588 |
|---|---|
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| 4-(2,4-dichlorophenoxy)butanoic acid compound with N-methylmethanamine (1:1) |
| Caswell No. 316C |
| 4-(2,4-dichlorophenoxy)butyric acid - dimethylamine (1:1) |
| 4-(2,4-dichlorophenoxy)butanoic acid—N-methylmethanamine |
| EINECS 220-422-0 |
| 4-(2,4-dichlorophenoxy)butanoic acid,N-methylmethanamine |
| 2,4-DB-Dimethylammonium |
| dimethylammonium 4-(2,4-dichlorophenoxy)butyrate |