(carboxylatomethyl)di(methyl)octylammonium structure
|
Common Name | (carboxylatomethyl)di(methyl)octylammonium | ||
|---|---|---|---|---|
| CAS Number | 27593-14-2 | Molecular Weight | 215.33200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H25NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[dimethyl(octyl)azaniumyl]acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H25NO2 |
|---|---|
| Molecular Weight | 215.33200 |
| Exact Mass | 215.18900 |
| PSA | 40.13000 |
| LogP | 1.17320 |
| InChIKey | YPUUGRMTUUCONZ-UHFFFAOYSA-N |
| SMILES | CCCCCCCC[N+](C)(C)CC(=O)[O-] |
|
~%
(carboxylatomet... CAS#:27593-14-2 |
| Literature: Beckett,A.H.; Woodward,R.J. Journal of Pharmacy and Pharmacology, 1963 , vol. 15, p. 422 - 431 |
|
~%
(carboxylatomet... CAS#:27593-14-2 |
| Literature: Beckett,A.H.; Woodward,R.J. Journal of Pharmacy and Pharmacology, 1963 , vol. 15, p. 422 - 431 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| octyl betaine |
| N-Octyl-N,N-dimethylglycin |
| octyl-N-betaine |
| (Dimethyl-octyl-ammonio)-acetat |
| Carboxymethyl-dimethyl-octyl-ammonium-betain |
| (Carboxylatomethyl)di(methyl)octylammonium |
| EINECS 248-551-8 |
| carboxymethyl-dimethyl-octyl-ammonium betaine |
| [dimethyl(octyl)ammonio]acetate |
| Octyldimethylbetaine |