1-isocyanato-4-[(4-isocyanatophenyl)methyl]-2-methylbenzene structure
|
Common Name | 1-isocyanato-4-[(4-isocyanatophenyl)methyl]-2-methylbenzene | ||
|---|---|---|---|---|
| CAS Number | 2761-21-9 | Molecular Weight | 264.27900 | |
| Density | 1.11g/cm3 | Boiling Point | 392.1ºC at 760mmHg | |
| Molecular Formula | C16H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.9ºC | |
| Name | 1-isocyanato-4-[(4-isocyanatophenyl)methyl]-2-methylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 392.1ºC at 760mmHg |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.27900 |
| Flash Point | 161.9ºC |
| Exact Mass | 264.09000 |
| PSA | 58.86000 |
| LogP | 3.52040 |
| Vapour Pressure | 2.34E-06mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | LWCCXOJTEVAEKM-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cc2ccc(N=C=O)cc2)ccc1N=C=O |
| 1-isocyanato-4-(4-isocyanatobenzyl)-2-methylbenzene |
| Diisocyanic acid,diester with 4-(p-hydroxybenzyl)-o-cresol |
| 3-methyldiphenylmethane4,4'-di-isocyanate |
| EINECS 220-428-3 |
| 4,4'-Diisocyanato-3-methyldiphenylmethan |
| 3-methyl-4,4'-diisocyanatodiphenylmethane |